The physical and chemical property of 3235-09-4 is provided by ChemNet.com
ChemNet > CAS > 3235-09-4 ?????? O-cresolate? ???? 2-?????? ??? ?????? (1:1)? ???? 2-????? ??? ??????? ?????? O-cresolate? 7-???????? ?????-4-en-3-one? ?????? 2-???? ???????
3235-09-4 ?????? O-cresolate? ???? 2-?????? ??? ?????? (1:1)? ???? 2-????? ??? ??????? ?????? O-cresolate? 7-???????? ?????-4-en-3-one? ?????? 2-???? ???????
| ??? ????? |
?????? O-cresolate? ???? 2-?????? ??? ?????? (1:1)? ???? 2-????? ??? ??????? ?????? O-cresolate? 7-???????? ?????-4-en-3-one? ?????? 2-???? ??????? |
| ??? ??????? |
potassium o-cresolate;Phenol, 2-methyl-, potassium salt (1:1); Phenol, 2-methyl-, potassium salt; Potassium o-cresolate; 7-hydroxycholest-4-en-3-one; potassium 2-methylphenolate |
| ????? ???????? |
C7H7KO |
| ??? ??????? |
146.2282 |
| InChI |
InChI=1/C7H8O.K/c1-6-4-2-3-5-7(6)8;/h2-5,8H,1H3;/q;+1/p-1 |
| ????? ?????? |
3235-09-4 |
| ????? ??????? ??????? |
221-790-5 |
| ?????? ??????? |
|
| ???? ????? |
191°C at 760 mmHg |
| ???? ?????? |
81.1°C |
| ???? ???? |
0.379mmHg at 25°C |
|